C24H26N6O2 — CID 157378204
2-[3-[[[2-[2-amino-6-(3-methylphenyl)pyrimidin-4-yl]-2-hydrazinylideneethylidene]amino]methyl]phenyl]-2-methylpropanoic acid (PubChem CID 157378204) has the molecular formula C24H26N6O2 and a molecular weight of 430.51 g/mol. Its IUPAC name is 2-[3-[[[2-[2-amino-6-(3-methylphenyl)pyrimidin-4-yl]-2-hydrazinylideneethylidene]amino]methyl]phenyl]-2-methylpropanoic acid.
| Compound Name | 2-[3-[[[2-[2-amino-6-(3-methylphenyl)pyrimidin-4-yl]-2-hydrazinylideneethylidene]amino]methyl]phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 157378204 |
| Molecular Formula | C24H26N6O2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 2-[3-[[[2-[2-amino-6-(3-methylphenyl)pyrimidin-4-yl]-2-hydrazinylideneethylidene]amino]methyl]phenyl]-2-methylpropanoic acid |
| SMILES | Cc1cccc(-c2cc(C(/C=N/Cc3cccc(C(C)(C)C(=O)O)c3)=NN)nc(N)n2)c1 |
| InChI | InChI=1S/C24H26N6O2/c1-15-6-4-8-17(10-15)19-12-20(29-23(25)28-19)21(30-26)14-27-13-16-7-5-9-18(11-16)24(2,3)22(31)32/h4-12,14H,13,26H2,1-3H3,(H,31,32)(H2,25,28,29)/b27-14+,30-21? |
| InChIKey | OYQBCWDCDGODPV-HRSIQIOISA-N |
| XLogP | 3.33 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|