About 1H-azepine;indol-2-one
1H-azepine;indol-2-one (PubChem CID 157383970) has the molecular formula C14H12N2O
and a molecular weight of 224.26 g/mol. Its IUPAC name is 1H-azepine;indol-2-one.
Molecular Properties
| Compound Name | 1H-azepine;indol-2-one |
| PubChem CID | 157383970 |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 1H-azepine;indol-2-one |
| SMILES | C1=CC=CNC=C1.O=C1C=c2ccccc2=N1 |
| InChI | InChI=1S/C8H5NO.C6H7N/c10-8-5-6-3-1-2-4-7(6)9-8;1-2-4-6-7-5-3-1/h1-5H;1-7H |
| InChIKey | BLFCENONSKZWDY-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-azepine;indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-azepine;indol-2-one?
The IUPAC name of 1H-azepine;indol-2-one (CID 157383970) is 1H-azepine;indol-2-one.
What is the SMILES notation for 1H-azepine;indol-2-one?
The canonical SMILES for 1H-azepine;indol-2-one is C1=CC=CNC=C1.O=C1C=c2ccccc2=N1.
What is the InChIKey of 1H-azepine;indol-2-one?
The InChIKey is BLFCENONSKZWDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO.C6H7N/c10-8-5-6-3-1-2-4-7(6)9-8;1-2-4-6-7-5-3-1/h1-5H;1-7H.
What are the key properties of 1H-azepine;indol-2-one?
1H-azepine;indol-2-one has a molecular weight of 224.26 g/mol, XLogP of 0.80, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-azepine;indol-2-one is sourced from PubChem (CID 157383970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).