C29H27F3N6O7S — CID 157384054
methyl 4-(ethylamino)-3-nitrobenzoate;methyl 1-ethyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxylate (PubChem CID 157384054) has the molecular formula C29H27F3N6O7S and a molecular weight of 660.63 g/mol. Its IUPAC name is methyl 4-(ethylamino)-3-nitrobenzoate;methyl 1-ethyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxylate.
| Compound Name | methyl 4-(ethylamino)-3-nitrobenzoate;methyl 1-ethyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 157384054 |
| Molecular Formula | C29H27F3N6O7S |
| Molecular Weight | 660.63 g/mol |
| Exact Mass | 660.16 |
| IUPAC Name | methyl 4-(ethylamino)-3-nitrobenzoate;methyl 1-ethyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxylate |
| SMILES | CCNc1ccc(C(=O)OC)cc1[N+](=O)[O-].CCn1c(Nc2nc3ccc(OC(F)(F)F)cc3s2)nc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C19H15F3N4O3S.C10H12N2O4/c1-3-26-14-7-4-10(16(27)28-2)8-13(14)23-17(26)25-18-24-12-6-5-11(9-15(12)30-18)29-19(20,21)22;1-3-11-8-5-4-7(10(13)16-2)6-9(8)12(14)15/h4-9H,3H2,1-2H3,(H,23,24,25);4-6,11H,3H2,1-2H3 |
| InChIKey | BLFIGOKAHCXZME-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 159.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.63 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|