C9H9NOS2Zn — CID 157385165
7-ethoxy-3H-1,3-benzothiazole-2-thione;zinc (PubChem CID 157385165) has the molecular formula C9H9NOS2Zn and a molecular weight of 276.70 g/mol. Its IUPAC name is 7-ethoxy-3H-1,3-benzothiazole-2-thione;zinc.
| Compound Name | 7-ethoxy-3H-1,3-benzothiazole-2-thione;zinc |
|---|---|
| PubChem CID | 157385165 |
| Molecular Formula | C9H9NOS2Zn |
| Molecular Weight | 276.70 g/mol |
| Exact Mass | 274.94 |
| IUPAC Name | 7-ethoxy-3H-1,3-benzothiazole-2-thione;zinc |
| SMILES | CCOc1cccc2[nH]c(=S)sc12.[Zn] |
| InChI | InChI=1S/C9H9NOS2.Zn/c1-2-11-7-5-3-4-6-8(7)13-9(12)10-6;/h3-5H,2H2,1H3,(H,10,12); |
| InChIKey | BLIQSCAGLZPUGT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.70 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|