C23H29NO5S — CID 157390492
3-acetyl-N-[2-(3-cyclobutyl-3-hydroxypropyl)-4-ethylphenyl]-4-hydroxybenzenesulfonamide (PubChem CID 157390492) has the molecular formula C23H29NO5S and a molecular weight of 431.55 g/mol. Its IUPAC name is 3-acetyl-N-[2-(3-cyclobutyl-3-hydroxypropyl)-4-ethylphenyl]-4-hydroxybenzenesulfonamide.
| Compound Name | 3-acetyl-N-[2-(3-cyclobutyl-3-hydroxypropyl)-4-ethylphenyl]-4-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 157390492 |
| Molecular Formula | C23H29NO5S |
| Molecular Weight | 431.55 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 3-acetyl-N-[2-(3-cyclobutyl-3-hydroxypropyl)-4-ethylphenyl]-4-hydroxybenzenesulfonamide |
| SMILES | CCc1ccc(NS(=O)(=O)c2ccc(O)c(C(C)=O)c2)c(CCC(O)C2CCC2)c1 |
| InChI | InChI=1S/C23H29NO5S/c1-3-16-7-10-21(18(13-16)8-11-22(26)17-5-4-6-17)24-30(28,29)19-9-12-23(27)20(14-19)15(2)25/h7,9-10,12-14,17,22,24,26-27H,3-6,8,11H2,1-2H3 |
| InChIKey | JVIPGRQAQYXGTE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |