C27H40Cl2N4O5 — CID 157399293
5-[(1S,2S,5R)-3-[(2S)-2-(tert-butylcarbamoylamino)-2-cyclohexylacetyl]-6,6-dichloro-3-azabicyclo[3.1.0]hexan-2-yl]-3-(cyclopropylmethyl)-2,5-dioxopentanamide (PubChem CID 157399293) has the molecular formula C27H40Cl2N4O5 and a molecular weight of 571.55 g/mol. Its IUPAC name is 5-[(1S,2S,5R)-3-[(2S)-2-(tert-butylcarbamoylamino)-2-cyclohexylacetyl]-6,6-dichloro-3-azabicyclo[3.1.0]hexan-2-yl]-3-(cyclopropylmethyl)-2,5-dioxopentanamide.
| Compound Name | 5-[(1S,2S,5R)-3-[(2S)-2-(tert-butylcarbamoylamino)-2-cyclohexylacetyl]-6,6-dichloro-3-azabicyclo[3.1.0]hexan-2-yl]-3-(cyclopropylmethyl)-2,5-dioxopentanamide |
|---|---|
| PubChem CID | 157399293 |
| Molecular Formula | C27H40Cl2N4O5 |
| Molecular Weight | 571.55 g/mol |
| Exact Mass | 570.24 |
| IUPAC Name | 5-[(1S,2S,5R)-3-[(2S)-2-(tert-butylcarbamoylamino)-2-cyclohexylacetyl]-6,6-dichloro-3-azabicyclo[3.1.0]hexan-2-yl]-3-(cyclopropylmethyl)-2,5-dioxopentanamide |
| SMILES | CC(C)(C)NC(=O)N[C@H](C(=O)N1C[C@H]2[C@@H]([C@H]1C(=O)CC(CC1CC1)C(=O)C(N)=O)C2(Cl)Cl)C1CCCCC1 |
| InChI | InChI=1S/C27H40Cl2N4O5/c1-26(2,3)32-25(38)31-20(15-7-5-4-6-8-15)24(37)33-13-17-19(27(17,28)29)21(33)18(34)12-16(11-14-9-10-14)22(35)23(30)36/h14-17,19-21H,4-13H2,1-3H3,(H2,30,36)(H2,31,32,38)/t16?,17-,19-,20-,21+/m0/s1 |
| InChIKey | GBHBVXATZONAEN-LWKDCUQFSA-N |
| XLogP | 3.09 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.55 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|