C27H44N4O5 — CID 58262650
5-[(1R,2S,5S)-3-[(2S)-2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]-3-(cyclopropylmethyl)-2,5-dioxopentanamide (PubChem CID 58262650) has the molecular formula C27H44N4O5 and a molecular weight of 504.67 g/mol. Its IUPAC name is 5-[(1R,2S,5S)-3-[(2S)-2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]-3-(cyclopropylmethyl)-2,5-dioxopentanamide.
| Compound Name | 5-[(1R,2S,5S)-3-[(2S)-2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]-3-(cyclopropylmethyl)-2,5-dioxopentanamide |
|---|---|
| PubChem CID | 58262650 |
| Molecular Formula | C27H44N4O5 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.33 |
| IUPAC Name | 5-[(1R,2S,5S)-3-[(2S)-2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]-3-(cyclopropylmethyl)-2,5-dioxopentanamide |
| SMILES | CC(C)(C)NC(=O)N[C@H](C(=O)N1C[C@H]2[C@@H]([C@H]1C(=O)CC(CC1CC1)C(=O)C(N)=O)C2(C)C)C(C)(C)C |
| InChI | InChI=1S/C27H44N4O5/c1-25(2,3)21(29-24(36)30-26(4,5)6)23(35)31-13-16-18(27(16,7)8)19(31)17(32)12-15(11-14-9-10-14)20(33)22(28)34/h14-16,18-19,21H,9-13H2,1-8H3,(H2,28,34)(H2,29,30,36)/t15?,16-,18-,19+,21+/m0/s1 |
| InChIKey | CUSMSBGYPLOLBC-NMJMEOIESA-N |
| XLogP | 2.41 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|