C27H43N3O6 — CID 161463135
tert-butyl N-[(2S)-1-[(1R,2S)-2-[5-amino-3-(cyclopropylmethyl)-4,5-dioxopentanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate (PubChem CID 161463135) has the molecular formula C27H43N3O6 and a molecular weight of 505.66 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[(1R,2S)-2-[5-amino-3-(cyclopropylmethyl)-4,5-dioxopentanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[(1R,2S)-2-[5-amino-3-(cyclopropylmethyl)-4,5-dioxopentanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 161463135 |
| Molecular Formula | C27H43N3O6 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.32 |
| IUPAC Name | tert-butyl N-[(2S)-1-[(1R,2S)-2-[5-amino-3-(cyclopropylmethyl)-4,5-dioxopentanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)N1CC2[C@@H]([C@H]1C(=O)CC(CC1CC1)C(=O)C(N)=O)C2(C)C)C(C)(C)C |
| InChI | InChI=1S/C27H43N3O6/c1-25(2,3)21(29-24(35)36-26(4,5)6)23(34)30-13-16-18(27(16,7)8)19(30)17(31)12-15(11-14-9-10-14)20(32)22(28)33/h14-16,18-19,21H,9-13H2,1-8H3,(H2,28,33)(H,29,35)/t15?,16?,18-,19+,21+/m0/s1 |
| InChIKey | AIYCSUVHRYVSJN-QNSNYMDOSA-N |
| XLogP | 2.84 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|