C29H45N3O6 — CID 158059278
tert-butyl N-[(1S)-2-[(3S,3aS,6aR)-3-[5-amino-3-(cyclopropylmethyl)-4,5-dioxopentanoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-cyclohexyl-2-oxoethyl]carbamate (PubChem CID 158059278) has the molecular formula C29H45N3O6 and a molecular weight of 531.69 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-[(3S,3aS,6aR)-3-[5-amino-3-(cyclopropylmethyl)-4,5-dioxopentanoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-cyclohexyl-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-[(3S,3aS,6aR)-3-[5-amino-3-(cyclopropylmethyl)-4,5-dioxopentanoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-cyclohexyl-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 158059278 |
| Molecular Formula | C29H45N3O6 |
| Molecular Weight | 531.69 g/mol |
| Exact Mass | 531.33 |
| IUPAC Name | tert-butyl N-[(1S)-2-[(3S,3aS,6aR)-3-[5-amino-3-(cyclopropylmethyl)-4,5-dioxopentanoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-cyclohexyl-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)N1C[C@@H]2CCC[C@@H]2[C@H]1C(=O)CC(CC1CC1)C(=O)C(N)=O)C1CCCCC1 |
| InChI | InChI=1S/C29H45N3O6/c1-29(2,3)38-28(37)31-23(18-8-5-4-6-9-18)27(36)32-16-19-10-7-11-21(19)24(32)22(33)15-20(14-17-12-13-17)25(34)26(30)35/h17-21,23-24H,4-16H2,1-3H3,(H2,30,35)(H,31,37)/t19-,20?,21-,23-,24-/m0/s1 |
| InChIKey | OYFAAHCXXNBLFI-RHHNHKTJSA-N |
| XLogP | 3.52 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.69 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|