C19H23ClFNO3 — CID 157399744
tert-butyl (2S)-2-[3-(3-chloro-2-fluorophenyl)propanoyl]-4-methylidenepyrrolidine-1-carboxylate (PubChem CID 157399744) has the molecular formula C19H23ClFNO3 and a molecular weight of 367.85 g/mol. Its IUPAC name is tert-butyl (2S)-2-[3-(3-chloro-2-fluorophenyl)propanoyl]-4-methylidenepyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[3-(3-chloro-2-fluorophenyl)propanoyl]-4-methylidenepyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 157399744 |
| Molecular Formula | C19H23ClFNO3 |
| Molecular Weight | 367.85 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | tert-butyl (2S)-2-[3-(3-chloro-2-fluorophenyl)propanoyl]-4-methylidenepyrrolidine-1-carboxylate |
| SMILES | C=C1C[C@@H](C(=O)CCc2cccc(Cl)c2F)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C19H23ClFNO3/c1-12-10-15(22(11-12)18(24)25-19(2,3)4)16(23)9-8-13-6-5-7-14(20)17(13)21/h5-7,15H,1,8-11H2,2-4H3/t15-/m0/s1 |
| InChIKey | GIUIUZNVHIPQJA-HNNXBMFYSA-N |
| XLogP | 4.55 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.85 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|