C17H20ClF2N5O3 — CID 118241549
tert-butyl (2S,3S,4S)-3-azido-2-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-4-fluoropyrrolidine-1-carboxylate (PubChem CID 118241549) has the molecular formula C17H20ClF2N5O3 and a molecular weight of 415.83 g/mol. Its IUPAC name is tert-butyl (2S,3S,4S)-3-azido-2-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-4-fluoropyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3S,4S)-3-azido-2-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-4-fluoropyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 118241549 |
| Molecular Formula | C17H20ClF2N5O3 |
| Molecular Weight | 415.83 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | tert-butyl (2S,3S,4S)-3-azido-2-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-4-fluoropyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](F)[C@@H](N=[N+]=[N-])[C@H]1C(=O)NCc1cccc(Cl)c1F |
| InChI | InChI=1S/C17H20ClF2N5O3/c1-17(2,3)28-16(27)25-8-11(19)13(23-24-21)14(25)15(26)22-7-9-5-4-6-10(18)12(9)20/h4-6,11,13-14H,7-8H2,1-3H3,(H,22,26)/t11-,13+,14-/m0/s1 |
| InChIKey | PBNHUBODWBOZCJ-YUTCNCBUSA-N |
| XLogP | 3.73 |
| TPSA | 107.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.83 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|