C24H34ClFN2O4 — CID 162768774
tert-butyl (2S,3R)-2-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-3-hept-6-enoxypyrrolidine-1-carboxylate (PubChem CID 162768774) has the molecular formula C24H34ClFN2O4 and a molecular weight of 469.00 g/mol. Its IUPAC name is tert-butyl (2S,3R)-2-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-3-hept-6-enoxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3R)-2-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-3-hept-6-enoxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 162768774 |
| Molecular Formula | C24H34ClFN2O4 |
| Molecular Weight | 469.00 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | tert-butyl (2S,3R)-2-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-3-hept-6-enoxypyrrolidine-1-carboxylate |
| SMILES | C=CCCCCCO[C@@H]1CCN(C(=O)OC(C)(C)C)[C@@H]1C(=O)NCc1cccc(Cl)c1F |
| InChI | InChI=1S/C24H34ClFN2O4/c1-5-6-7-8-9-15-31-19-13-14-28(23(30)32-24(2,3)4)21(19)22(29)27-16-17-11-10-12-18(25)20(17)26/h5,10-12,19,21H,1,6-9,13-16H2,2-4H3,(H,27,29)/t19-,21+/m1/s1 |
| InChIKey | YXTHNBCSVNQXLV-CTNGQTDRSA-N |
| XLogP | 5.24 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.00 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|