C13H28N2O4 — CID 157400668
2-amino-2-methylbutanoic acid;2-(diethylamino)-2-methylpropanoic acid (PubChem CID 157400668) has the molecular formula C13H28N2O4 and a molecular weight of 276.38 g/mol. Its IUPAC name is 2-amino-2-methylbutanoic acid;2-(diethylamino)-2-methylpropanoic acid.
| Compound Name | 2-amino-2-methylbutanoic acid;2-(diethylamino)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 157400668 |
| Molecular Formula | C13H28N2O4 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 2-amino-2-methylbutanoic acid;2-(diethylamino)-2-methylpropanoic acid |
| SMILES | CCC(C)(N)C(=O)O.CCN(CC)C(C)(C)C(=O)O |
| InChI | InChI=1S/C8H17NO2.C5H11NO2/c1-5-9(6-2)8(3,4)7(10)11;1-3-5(2,6)4(7)8/h5-6H2,1-4H3,(H,10,11);3,6H2,1-2H3,(H,7,8) |
| InChIKey | BNCRYUQMXQXSMZ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |