C12H25NO2 — CID 61438417
2-[ethyl(2-ethylbutyl)amino]-2-methylpropanoic acid (PubChem CID 61438417) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is 2-[ethyl(2-ethylbutyl)amino]-2-methylpropanoic acid.
| Compound Name | 2-[ethyl(2-ethylbutyl)amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 61438417 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | 2-[ethyl(2-ethylbutyl)amino]-2-methylpropanoic acid |
| SMILES | CCC(CC)CN(CC)C(C)(C)C(=O)O |
| InChI | InChI=1S/C12H25NO2/c1-6-10(7-2)9-13(8-3)12(4,5)11(14)15/h10H,6-9H2,1-5H3,(H,14,15) |
| InChIKey | HZSXYMDCQRFEBI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |