About ethane;2-propan-2-ylfuran;3-propan-2-ylfuran
ethane;2-propan-2-ylfuran;3-propan-2-ylfuran (PubChem CID 157401311) has the molecular formula C18H32O2
and a molecular weight of 280.45 g/mol. Its IUPAC name is ethane;2-propan-2-ylfuran;3-propan-2-ylfuran.
Molecular Properties
| Compound Name | ethane;2-propan-2-ylfuran;3-propan-2-ylfuran |
| PubChem CID | 157401311 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | ethane;2-propan-2-ylfuran;3-propan-2-ylfuran |
| SMILES | CC.CC.CC(C)c1ccco1.CC(C)c1ccoc1 |
| InChI | InChI=1S/2C7H10O.2C2H6/c1-6(2)7-3-4-8-5-7;1-6(2)7-4-3-5-8-7;2*1-2/h2*3-6H,1-2H3;2*1-2H3 |
| InChIKey | BNEUTRKXQUZNDO-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-propan-2-ylfuran;3-propan-2-ylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-propan-2-ylfuran;3-propan-2-ylfuran?
The IUPAC name of ethane;2-propan-2-ylfuran;3-propan-2-ylfuran (CID 157401311) is ethane;2-propan-2-ylfuran;3-propan-2-ylfuran.
What is the SMILES notation for ethane;2-propan-2-ylfuran;3-propan-2-ylfuran?
The canonical SMILES for ethane;2-propan-2-ylfuran;3-propan-2-ylfuran is CC.CC.CC(C)c1ccco1.CC(C)c1ccoc1.
What is the InChIKey of ethane;2-propan-2-ylfuran;3-propan-2-ylfuran?
The InChIKey is BNEUTRKXQUZNDO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H10O.2C2H6/c1-6(2)7-3-4-8-5-7;1-6(2)7-4-3-5-8-7;2*1-2/h2*3-6H,1-2H3;2*1-2H3.
What are the key properties of ethane;2-propan-2-ylfuran;3-propan-2-ylfuran?
ethane;2-propan-2-ylfuran;3-propan-2-ylfuran has a molecular weight of 280.45 g/mol, XLogP of 6.86, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-propan-2-ylfuran;3-propan-2-ylfuran is sourced from PubChem (CID 157401311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).