About 2-propan-2-ylaniline;2-propan-2-ylfuran
2-propan-2-ylaniline;2-propan-2-ylfuran (PubChem CID 158742039) has the molecular formula C16H23NO
and a molecular weight of 245.37 g/mol. Its IUPAC name is 2-propan-2-ylaniline;2-propan-2-ylfuran.
Molecular Properties
| Compound Name | 2-propan-2-ylaniline;2-propan-2-ylfuran |
| PubChem CID | 158742039 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 2-propan-2-ylaniline;2-propan-2-ylfuran |
| SMILES | CC(C)c1ccccc1N.CC(C)c1ccco1 |
| InChI | InChI=1S/C9H13N.C7H10O/c1-7(2)8-5-3-4-6-9(8)10;1-6(2)7-4-3-5-8-7/h3-7H,10H2,1-2H3;3-6H,1-2H3 |
| InChIKey | IMKLCYHKXABMNN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-propan-2-ylaniline;2-propan-2-ylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-ylaniline;2-propan-2-ylfuran?
The IUPAC name of 2-propan-2-ylaniline;2-propan-2-ylfuran (CID 158742039) is 2-propan-2-ylaniline;2-propan-2-ylfuran.
What is the SMILES notation for 2-propan-2-ylaniline;2-propan-2-ylfuran?
The canonical SMILES for 2-propan-2-ylaniline;2-propan-2-ylfuran is CC(C)c1ccccc1N.CC(C)c1ccco1.
What is the InChIKey of 2-propan-2-ylaniline;2-propan-2-ylfuran?
The InChIKey is IMKLCYHKXABMNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N.C7H10O/c1-7(2)8-5-3-4-6-9(8)10;1-6(2)7-4-3-5-8-7/h3-7H,10H2,1-2H3;3-6H,1-2H3.
What are the key properties of 2-propan-2-ylaniline;2-propan-2-ylfuran?
2-propan-2-ylaniline;2-propan-2-ylfuran has a molecular weight of 245.37 g/mol, XLogP of 4.80, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-ylaniline;2-propan-2-ylfuran is sourced from PubChem (CID 158742039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).