About (3-chlorophenyl)methylazanide;1-(2,5-dichlorophenyl)-3-(trifluoromethyl)pyrazole-5-carboxylic acid
(3-chlorophenyl)methylazanide;1-(2,5-dichlorophenyl)-3-(trifluoromethyl)pyrazole-5-carboxylic acid (PubChem CID 157403272) has the molecular formula C18H12Cl3F3N3O2-
and a molecular weight of 465.67 g/mol. Its IUPAC name is (3-chlorophenyl)methylazanide;1-(2,5-dichlorophenyl)-3-(trifluoromethyl)pyrazole-5-carboxylic acid.
Molecular Properties
| Compound Name | (3-chlorophenyl)methylazanide;1-(2,5-dichlorophenyl)-3-(trifluoromethyl)pyrazole-5-carboxylic acid |
| PubChem CID | 157403272 |
| Molecular Formula | C18H12Cl3F3N3O2- |
| Molecular Weight | 465.67 g/mol |
| Exact Mass | 464.00 |
| IUPAC Name | (3-chlorophenyl)methylazanide;1-(2,5-dichlorophenyl)-3-(trifluoromethyl)pyrazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(C(F)(F)F)nn1-c1cc(Cl)ccc1Cl.[NH-]Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C11H5Cl2F3N2O2.C7H7ClN/c12-5-1-2-6(13)7(3-5)18-8(10(19)20)4-9(17-18)11(14,15)16;8-7-3-1-2-6(4-7)5-9/h1-4H,(H,19,20);1-4,9H,5H2/q;-1 |
| InChIKey | BNKPGRSONNQOAE-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 465.67 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-chlorophenyl)methylazanide;1-(2,5-dichlorophenyl)-3-(trifluoromethyl)pyrazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chlorophenyl)methylazanide;1-(2,5-dichlorophenyl)-3-(trifluoromethyl)pyrazole-5-carboxylic acid?
The IUPAC name of (3-chlorophenyl)methylazanide;1-(2,5-dichlorophenyl)-3-(trifluoromethyl)pyrazole-5-carboxylic acid (CID 157403272) is (3-chlorophenyl)methylazanide;1-(2,5-dichlorophenyl)-3-(trifluoromethyl)pyrazole-5-carboxylic acid.
What is the SMILES notation for (3-chlorophenyl)methylazanide;1-(2,5-dichlorophenyl)-3-(trifluoromethyl)pyrazole-5-carboxylic acid?
The canonical SMILES for (3-chlorophenyl)methylazanide;1-(2,5-dichlorophenyl)-3-(trifluoromethyl)pyrazole-5-carboxylic acid is O=C(O)c1cc(C(F)(F)F)nn1-c1cc(Cl)ccc1Cl.[NH-]Cc1cccc(Cl)c1.
What is the InChIKey of (3-chlorophenyl)methylazanide;1-(2,5-dichlorophenyl)-3-(trifluoromethyl)pyrazole-5-carboxylic acid?
The InChIKey is BNKPGRSONNQOAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5Cl2F3N2O2.C7H7ClN/c12-5-1-2-6(13)7(3-5)18-8(10(19)20)4-9(17-18)11(14,15)16;8-7-3-1-2-6(4-7)5-9/h1-4H,(H,19,20);1-4,9H,5H2/q;-1.
What are the key properties of (3-chlorophenyl)methylazanide;1-(2,5-dichlorophenyl)-3-(trifluoromethyl)pyrazole-5-carboxylic acid?
(3-chlorophenyl)methylazanide;1-(2,5-dichlorophenyl)-3-(trifluoromethyl)pyrazole-5-carboxylic acid has a molecular weight of 465.67 g/mol, XLogP of 6.79, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chlorophenyl)methylazanide;1-(2,5-dichlorophenyl)-3-(trifluoromethyl)pyrazole-5-carboxylic acid is sourced from PubChem (CID 157403272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).