About (2-bromophenyl)boronic acid;1-(2-bromophenyl)isoquinoline;1-chloroisoquinoline
(2-bromophenyl)boronic acid;1-(2-bromophenyl)isoquinoline;1-chloroisoquinoline (PubChem CID 157406022) has the molecular formula C30H22BBr2ClN2O2
and a molecular weight of 648.59 g/mol. Its IUPAC name is (2-bromophenyl)boronic acid;1-(2-bromophenyl)isoquinoline;1-chloroisoquinoline.
Molecular Properties
| Compound Name | (2-bromophenyl)boronic acid;1-(2-bromophenyl)isoquinoline;1-chloroisoquinoline |
| PubChem CID | 157406022 |
| Molecular Formula | C30H22BBr2ClN2O2 |
| Molecular Weight | 648.59 g/mol |
| Exact Mass | 645.98 |
| IUPAC Name | (2-bromophenyl)boronic acid;1-(2-bromophenyl)isoquinoline;1-chloroisoquinoline |
| SMILES | Brc1ccccc1-c1nccc2ccccc12.Clc1nccc2ccccc12.OB(O)c1ccccc1Br |
| InChI | InChI=1S/C15H10BrN.C9H6ClN.C6H6BBrO2/c16-14-8-4-3-7-13(14)15-12-6-2-1-5-11(12)9-10-17-15;10-9-8-4-2-1-3-7(8)5-6-11-9;8-6-4-2-1-3-5(6)7(9)10/h1-10H;1-6H;1-4,9-10H |
| InChIKey | BNSKWVONQDFOAB-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 648.59 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-bromophenyl)boronic acid;1-(2-bromophenyl)isoquinoline;1-chloroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromophenyl)boronic acid;1-(2-bromophenyl)isoquinoline;1-chloroisoquinoline?
The IUPAC name of (2-bromophenyl)boronic acid;1-(2-bromophenyl)isoquinoline;1-chloroisoquinoline (CID 157406022) is (2-bromophenyl)boronic acid;1-(2-bromophenyl)isoquinoline;1-chloroisoquinoline.
What is the SMILES notation for (2-bromophenyl)boronic acid;1-(2-bromophenyl)isoquinoline;1-chloroisoquinoline?
The canonical SMILES for (2-bromophenyl)boronic acid;1-(2-bromophenyl)isoquinoline;1-chloroisoquinoline is Brc1ccccc1-c1nccc2ccccc12.Clc1nccc2ccccc12.OB(O)c1ccccc1Br.
What is the InChIKey of (2-bromophenyl)boronic acid;1-(2-bromophenyl)isoquinoline;1-chloroisoquinoline?
The InChIKey is BNSKWVONQDFOAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10BrN.C9H6ClN.C6H6BBrO2/c16-14-8-4-3-7-13(14)15-12-6-2-1-5-11(12)9-10-17-15;10-9-8-4-2-1-3-7(8)5-6-11-9;8-6-4-2-1-3-5(6)7(9)10/h1-10H;1-6H;1-4,9-10H.
What are the key properties of (2-bromophenyl)boronic acid;1-(2-bromophenyl)isoquinoline;1-chloroisoquinoline?
(2-bromophenyl)boronic acid;1-(2-bromophenyl)isoquinoline;1-chloroisoquinoline has a molecular weight of 648.59 g/mol, XLogP of 7.68, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromophenyl)boronic acid;1-(2-bromophenyl)isoquinoline;1-chloroisoquinoline is sourced from PubChem (CID 157406022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).