C26H28N2O2 — CID 157407321
5-(4-ethylphenyl)-2,3-bis(4-methoxyphenyl)-4-methyl-2,4-dihydroimidazole (PubChem CID 157407321) has the molecular formula C26H28N2O2 and a molecular weight of 400.52 g/mol. Its IUPAC name is 5-(4-ethylphenyl)-2,3-bis(4-methoxyphenyl)-4-methyl-2,4-dihydroimidazole.
| Compound Name | 5-(4-ethylphenyl)-2,3-bis(4-methoxyphenyl)-4-methyl-2,4-dihydroimidazole |
|---|---|
| PubChem CID | 157407321 |
| Molecular Formula | C26H28N2O2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 5-(4-ethylphenyl)-2,3-bis(4-methoxyphenyl)-4-methyl-2,4-dihydroimidazole |
| SMILES | CCc1ccc(C2=NC(c3ccc(OC)cc3)N(c3ccc(OC)cc3)C2C)cc1 |
| InChI | InChI=1S/C26H28N2O2/c1-5-19-6-8-20(9-7-19)25-18(2)28(22-12-16-24(30-4)17-13-22)26(27-25)21-10-14-23(29-3)15-11-21/h6-18,26H,5H2,1-4H3 |
| InChIKey | RXZMUGHZKYVEMT-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|