C23H20BrIN2O2 — CID 163790890
[4-[3-(4-bromophenyl)-2-(4-methoxyphenyl)-4-methyl-2,4-dihydroimidazol-5-yl]phenyl] hypoiodite (PubChem CID 163790890) has the molecular formula C23H20BrIN2O2 and a molecular weight of 563.23 g/mol. Its IUPAC name is [4-[3-(4-bromophenyl)-2-(4-methoxyphenyl)-4-methyl-2,4-dihydroimidazol-5-yl]phenyl] hypoiodite.
| Compound Name | [4-[3-(4-bromophenyl)-2-(4-methoxyphenyl)-4-methyl-2,4-dihydroimidazol-5-yl]phenyl] hypoiodite |
|---|---|
| PubChem CID | 163790890 |
| Molecular Formula | C23H20BrIN2O2 |
| Molecular Weight | 563.23 g/mol |
| Exact Mass | 561.98 |
| IUPAC Name | [4-[3-(4-bromophenyl)-2-(4-methoxyphenyl)-4-methyl-2,4-dihydroimidazol-5-yl]phenyl] hypoiodite |
| SMILES | COc1ccc(C2N=C(c3ccc(OI)cc3)C(C)N2c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C23H20BrIN2O2/c1-15-22(16-3-13-21(29-25)14-4-16)26-23(17-5-11-20(28-2)12-6-17)27(15)19-9-7-18(24)8-10-19/h3-15,23H,1-2H3 |
| InChIKey | MWPXDOPFWYKYPV-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.23 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|