C28H41N3O6 — CID 157407341
[(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[2-[4-[[(2S)-2-aminopropanoyl]amino]phenyl]ethyl]carbamate (PubChem CID 157407341) has the molecular formula C28H41N3O6 and a molecular weight of 515.65 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[2-[4-[[(2S)-2-aminopropanoyl]amino]phenyl]ethyl]carbamate.
| Compound Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[2-[4-[[(2S)-2-aminopropanoyl]amino]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 157407341 |
| Molecular Formula | C28H41N3O6 |
| Molecular Weight | 515.65 g/mol |
| Exact Mass | 515.30 |
| IUPAC Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[2-[4-[[(2S)-2-aminopropanoyl]amino]phenyl]ethyl]carbamate |
| SMILES | CO[C@@H]1[C@H](OC(=O)NCCc2ccc(NC(=O)[C@H](C)N)cc2)CC[C@]2(CO2)[C@H]1[C@]1(C)O[C@@H]1CC=C(C)C |
| InChI | InChI=1S/C28H41N3O6/c1-17(2)6-11-22-27(4,37-22)24-23(34-5)21(12-14-28(24)16-35-28)36-26(33)30-15-13-19-7-9-20(10-8-19)31-25(32)18(3)29/h6-10,18,21-24H,11-16,29H2,1-5H3,(H,30,33)(H,31,32)/t18-,21+,22+,23+,24+,27+,28-/m0/s1 |
| InChIKey | WLSYRUVGTPDYFR-UGJNQNJPSA-N |
| XLogP | 3.32 |
| TPSA | 127.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.65 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|