C34H49NO8 — CID 160896928
[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 4-[4-[[2-(3,3-dimethyl-2-oxobutoxy)acetyl]amino]phenyl]butanoate (PubChem CID 160896928) has the molecular formula C34H49NO8 and a molecular weight of 599.77 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 4-[4-[[2-(3,3-dimethyl-2-oxobutoxy)acetyl]amino]phenyl]butanoate.
| Compound Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 4-[4-[[2-(3,3-dimethyl-2-oxobutoxy)acetyl]amino]phenyl]butanoate |
|---|---|
| PubChem CID | 160896928 |
| Molecular Formula | C34H49NO8 |
| Molecular Weight | 599.77 g/mol |
| Exact Mass | 599.35 |
| IUPAC Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 4-[4-[[2-(3,3-dimethyl-2-oxobutoxy)acetyl]amino]phenyl]butanoate |
| SMILES | CO[C@@H]1[C@H](OC(=O)CCCc2ccc(NC(=O)COCC(=O)C(C)(C)C)cc2)CC[C@]2(CO2)[C@H]1[C@@]1(C)O[C@@H]1CC=C(C)C |
| InChI | InChI=1S/C34H49NO8/c1-22(2)11-16-27-33(6,43-27)31-30(39-7)25(17-18-34(31)21-41-34)42-29(38)10-8-9-23-12-14-24(15-13-23)35-28(37)20-40-19-26(36)32(3,4)5/h11-15,25,27,30-31H,8-10,16-21H2,1-7H3,(H,35,37)/t25-,27-,30-,31-,33+,34+/m1/s1 |
| InChIKey | SOZOJMBVYLCPGE-CBZBUGFESA-N |
| XLogP | 5.20 |
| TPSA | 115.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.77 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|