C25H33NO7 — CID 23546974
[5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-(1,3-benzodioxol-5-ylamino)acetate (PubChem CID 23546974) has the molecular formula C25H33NO7 and a molecular weight of 459.54 g/mol. Its IUPAC name is [5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-(1,3-benzodioxol-5-ylamino)acetate.
| Compound Name | [5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-(1,3-benzodioxol-5-ylamino)acetate |
|---|---|
| PubChem CID | 23546974 |
| Molecular Formula | C25H33NO7 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | [5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-(1,3-benzodioxol-5-ylamino)acetate |
| SMILES | COC1C(OC(=O)CNc2ccc3c(c2)OCO3)CCC2(CO2)C1C1(C)OC1CC=C(C)C |
| InChI | InChI=1S/C25H33NO7/c1-15(2)5-8-20-24(3,33-20)23-22(28-4)18(9-10-25(23)13-31-25)32-21(27)12-26-16-6-7-17-19(11-16)30-14-29-17/h5-7,11,18,20,22-23,26H,8-10,12-14H2,1-4H3 |
| InChIKey | CFPBEIXGTYJDTK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 91.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|