C24H31NO7 — CID 138689978
4-[[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonylamino]benzoic acid (PubChem CID 138689978) has the molecular formula C24H31NO7 and a molecular weight of 445.51 g/mol. Its IUPAC name is 4-[[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonylamino]benzoic acid.
| Compound Name | 4-[[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonylamino]benzoic acid |
|---|---|
| PubChem CID | 138689978 |
| Molecular Formula | C24H31NO7 |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 4-[[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonylamino]benzoic acid |
| SMILES | CO[C@@H]1[C@H](OC(=O)Nc2ccc(C(=O)O)cc2)CC[C@]2(CO2)[C@H]1[C@@]1(C)O[C@@H]1CC=C(C)C |
| InChI | InChI=1S/C24H31NO7/c1-14(2)5-10-18-23(3,32-18)20-19(29-4)17(11-12-24(20)13-30-24)31-22(28)25-16-8-6-15(7-9-16)21(26)27/h5-9,17-20H,10-13H2,1-4H3,(H,25,28)(H,26,27)/t17-,18-,19-,20-,23+,24+/m1/s1 |
| InChIKey | FHGHPZNMWGTSHF-LQCNHDFWSA-N |
| XLogP | 4.01 |
| TPSA | 109.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|