C26H36N2O9 — CID 142224128
[(3R,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-(4,5-dimethoxy-2-nitroanilino)acetate (PubChem CID 142224128) has the molecular formula C26H36N2O9 and a molecular weight of 520.58 g/mol. Its IUPAC name is [(3R,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-(4,5-dimethoxy-2-nitroanilino)acetate.
| Compound Name | [(3R,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-(4,5-dimethoxy-2-nitroanilino)acetate |
|---|---|
| PubChem CID | 142224128 |
| Molecular Formula | C26H36N2O9 |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | [(3R,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-(4,5-dimethoxy-2-nitroanilino)acetate |
| SMILES | COc1cc(NCC(=O)O[C@@H]2CC[C@]3(CO3)C(C3(C)O[C@@H]3CC=C(C)C)[C@@H]2OC)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C26H36N2O9/c1-15(2)7-8-21-25(3,37-21)24-23(34-6)18(9-10-26(24)14-35-26)36-22(29)13-27-16-11-19(32-4)20(33-5)12-17(16)28(30)31/h7,11-12,18,21,23-24,27H,8-10,13-14H2,1-6H3/t18-,21-,23-,24?,25?,26+/m1/s1 |
| InChIKey | DVSJSFYYTBCWDA-WHYDQJIWSA-N |
| XLogP | 3.64 |
| TPSA | 134.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|