C24H32N2O7 — CID 142224130
[(3R,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-(4-nitroanilino)acetate (PubChem CID 142224130) has the molecular formula C24H32N2O7 and a molecular weight of 460.53 g/mol. Its IUPAC name is [(3R,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-(4-nitroanilino)acetate.
| Compound Name | [(3R,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-(4-nitroanilino)acetate |
|---|---|
| PubChem CID | 142224130 |
| Molecular Formula | C24H32N2O7 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | [(3R,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-(4-nitroanilino)acetate |
| SMILES | CO[C@H]1C(C2(C)O[C@@H]2CC=C(C)C)[C@]2(CC[C@H]1OC(=O)CNc1ccc([N+](=O)[O-])cc1)CO2 |
| InChI | InChI=1S/C24H32N2O7/c1-15(2)5-10-19-23(3,33-19)22-21(30-4)18(11-12-24(22)14-31-24)32-20(27)13-25-16-6-8-17(9-7-16)26(28)29/h5-9,18-19,21-22,25H,10-14H2,1-4H3/t18-,19-,21-,22?,23?,24+/m1/s1 |
| InChIKey | JTBZIUPNFYDIOV-VUIGJTSOSA-N |
| XLogP | 3.63 |
| TPSA | 115.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|