C30H40O9 — CID 159767515
2-[3-[4-[3-[[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxy]-3-oxopropyl]phenyl]-2-oxopropoxy]acetic acid (PubChem CID 159767515) has the molecular formula C30H40O9 and a molecular weight of 544.64 g/mol. Its IUPAC name is 2-[3-[4-[3-[[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxy]-3-oxopropyl]phenyl]-2-oxopropoxy]acetic acid.
| Compound Name | 2-[3-[4-[3-[[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxy]-3-oxopropyl]phenyl]-2-oxopropoxy]acetic acid |
|---|---|
| PubChem CID | 159767515 |
| Molecular Formula | C30H40O9 |
| Molecular Weight | 544.64 g/mol |
| Exact Mass | 544.27 |
| IUPAC Name | 2-[3-[4-[3-[[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxy]-3-oxopropyl]phenyl]-2-oxopropoxy]acetic acid |
| SMILES | CO[C@@H]1[C@H](OC(=O)CCc2ccc(CC(=O)COCC(=O)O)cc2)CC[C@]2(CO2)[C@H]1[C@@]1(C)O[C@@H]1CC=C(C)C |
| InChI | InChI=1S/C30H40O9/c1-19(2)5-11-24-29(3,39-24)28-27(35-4)23(13-14-30(28)18-37-30)38-26(34)12-10-20-6-8-21(9-7-20)15-22(31)16-36-17-25(32)33/h5-9,23-24,27-28H,10-18H2,1-4H3,(H,32,33)/t23-,24-,27-,28-,29+,30+/m1/s1 |
| InChIKey | XHHACYVKOGYQLE-ZQBHYASFSA-N |
| XLogP | 3.45 |
| TPSA | 124.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.64 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|