C20H19NO4S — CID 157411053
5-[[2-[2-(2-methoxyphenoxy)ethoxy]phenyl]methylidene]-2-methylidene-1,3-thiazolidin-4-one (PubChem CID 157411053) has the molecular formula C20H19NO4S and a molecular weight of 369.44 g/mol. Its IUPAC name is 5-[[2-[2-(2-methoxyphenoxy)ethoxy]phenyl]methylidene]-2-methylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[2-[2-(2-methoxyphenoxy)ethoxy]phenyl]methylidene]-2-methylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 157411053 |
| Molecular Formula | C20H19NO4S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 5-[[2-[2-(2-methoxyphenoxy)ethoxy]phenyl]methylidene]-2-methylidene-1,3-thiazolidin-4-one |
| SMILES | C=c1[nH]c(=O)c(=Cc2ccccc2OCCOc2ccccc2OC)s1 |
| InChI | InChI=1S/C20H19NO4S/c1-14-21-20(22)19(26-14)13-15-7-3-4-8-16(15)24-11-12-25-18-10-6-5-9-17(18)23-2/h3-10,13H,1,11-12H2,2H3,(H,21,22) |
| InChIKey | SGLIAHFOWBSDKS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|