C13H14N2O2 — CID 90965007
(5Z)-5-[(2-methoxyphenyl)methylidene]-3-methyl-2-methylideneimidazolidin-4-one (PubChem CID 90965007) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is (5Z)-5-[(2-methoxyphenyl)methylidene]-3-methyl-2-methylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[(2-methoxyphenyl)methylidene]-3-methyl-2-methylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 90965007 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | (5Z)-5-[(2-methoxyphenyl)methylidene]-3-methyl-2-methylideneimidazolidin-4-one |
| SMILES | C=c1[nH]/c(=C\c2ccccc2OC)c(=O)n1C |
| InChI | InChI=1S/C13H14N2O2/c1-9-14-11(13(16)15(9)2)8-10-6-4-5-7-12(10)17-3/h4-8,14H,1H2,2-3H3/b11-8- |
| InChIKey | BLLKTRNNTJBGSQ-FLIBITNWSA-N |
| XLogP | -0.04 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |