C22H44O7 — CID 157413366
methane;3-methyl-4-[[2-[(3-methyl-2-oxooxolan-3-yl)methyl]-5-oxooxolan-2-yl]methyl]oxolane-2,5-dione (PubChem CID 157413366) has the molecular formula C22H44O7 and a molecular weight of 420.59 g/mol. Its IUPAC name is methane;3-methyl-4-[[2-[(3-methyl-2-oxooxolan-3-yl)methyl]-5-oxooxolan-2-yl]methyl]oxolane-2,5-dione.
| Compound Name | methane;3-methyl-4-[[2-[(3-methyl-2-oxooxolan-3-yl)methyl]-5-oxooxolan-2-yl]methyl]oxolane-2,5-dione |
|---|---|
| PubChem CID | 157413366 |
| Molecular Formula | C22H44O7 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.31 |
| IUPAC Name | methane;3-methyl-4-[[2-[(3-methyl-2-oxooxolan-3-yl)methyl]-5-oxooxolan-2-yl]methyl]oxolane-2,5-dione |
| SMILES | C.C.C.C.C.C.CC1C(=O)OC(=O)C1CC1(CC2(C)CCOC2=O)CCC(=O)O1 |
| InChI | InChI=1S/C16H20O7.6CH4/c1-9-10(13(19)22-12(9)18)7-16(4-3-11(17)23-16)8-15(2)5-6-21-14(15)20;;;;;;/h9-10H,3-8H2,1-2H3;6*1H4 |
| InChIKey | BONZKMTXZNTCTL-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|