C23H15N5OS — CID 157415519
[2-(1H-imidazol-2-yl)-4-isocyano-5-pyridazin-4-ylthiophen-3-yl]-naphthalen-2-ylmethanol (PubChem CID 157415519) has the molecular formula C23H15N5OS and a molecular weight of 409.47 g/mol. Its IUPAC name is [2-(1H-imidazol-2-yl)-4-isocyano-5-pyridazin-4-ylthiophen-3-yl]-naphthalen-2-ylmethanol.
| Compound Name | [2-(1H-imidazol-2-yl)-4-isocyano-5-pyridazin-4-ylthiophen-3-yl]-naphthalen-2-ylmethanol |
|---|---|
| PubChem CID | 157415519 |
| Molecular Formula | C23H15N5OS |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | [2-(1H-imidazol-2-yl)-4-isocyano-5-pyridazin-4-ylthiophen-3-yl]-naphthalen-2-ylmethanol |
| SMILES | [C-]#[N+]c1c(-c2ccnnc2)sc(-c2ncc[nH]2)c1C(O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H15N5OS/c1-24-19-18(20(29)16-7-6-14-4-2-3-5-15(14)12-16)22(23-25-10-11-26-23)30-21(19)17-8-9-27-28-13-17/h2-13,20,29H,(H,25,26) |
| InChIKey | FFYSWJXBAAOPIB-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 79.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|