C50H57Br2IN2O4 — CID 157417179
1-bromo-2-(3-iodopropyl)benzene;methyl 1-[3-(2-bromophenyl)propyl]-3-cyclohexylindole-6-carboxylate;methyl 3-cyclohexyl-1H-indole-6-carboxylate (PubChem CID 157417179) has the molecular formula C50H57Br2IN2O4 and a molecular weight of 1036.73 g/mol. Its IUPAC name is 1-bromo-2-(3-iodopropyl)benzene;methyl 1-[3-(2-bromophenyl)propyl]-3-cyclohexylindole-6-carboxylate;methyl 3-cyclohexyl-1H-indole-6-carboxylate.
| Compound Name | 1-bromo-2-(3-iodopropyl)benzene;methyl 1-[3-(2-bromophenyl)propyl]-3-cyclohexylindole-6-carboxylate;methyl 3-cyclohexyl-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 157417179 |
| Molecular Formula | C50H57Br2IN2O4 |
| Molecular Weight | 1036.73 g/mol |
| Exact Mass | 1034.17 |
| IUPAC Name | 1-bromo-2-(3-iodopropyl)benzene;methyl 1-[3-(2-bromophenyl)propyl]-3-cyclohexylindole-6-carboxylate;methyl 3-cyclohexyl-1H-indole-6-carboxylate |
| SMILES | Brc1ccccc1CCCI.COC(=O)c1ccc2c(C3CCCCC3)c[nH]c2c1.COC(=O)c1ccc2c(C3CCCCC3)cn(CCCc3ccccc3Br)c2c1 |
| InChI | InChI=1S/C25H28BrNO2.C16H19NO2.C9H10BrI/c1-29-25(28)20-13-14-21-22(18-8-3-2-4-9-18)17-27(24(21)16-20)15-7-11-19-10-5-6-12-23(19)26;1-19-16(18)12-7-8-13-14(10-17-15(13)9-12)11-5-3-2-4-6-11;10-9-6-2-1-4-8(9)5-3-7-11/h5-6,10,12-14,16-18H,2-4,7-9,11,15H2,1H3;7-11,17H,2-6H2,1H3;1-2,4,6H,3,5,7H2 |
| InChIKey | BOZJWMCFTZUIMP-UHFFFAOYSA-N |
| XLogP | 14.69 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1036.73 |
| LogP ≤ 5 | 14.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|