C36H25BrF8N2O3 — CID 159965960
6-bromo-5-fluoro-1-[[2-(trifluoromethyl)phenyl]methyl]indole;carbon monoxide;ethyl 5-fluoro-1-[[2-(trifluoromethyl)phenyl]methyl]indole-6-carboxylate (PubChem CID 159965960) has the molecular formula C36H25BrF8N2O3 and a molecular weight of 765.50 g/mol. Its IUPAC name is 6-bromo-5-fluoro-1-[[2-(trifluoromethyl)phenyl]methyl]indole;carbon monoxide;ethyl 5-fluoro-1-[[2-(trifluoromethyl)phenyl]methyl]indole-6-carboxylate.
| Compound Name | 6-bromo-5-fluoro-1-[[2-(trifluoromethyl)phenyl]methyl]indole;carbon monoxide;ethyl 5-fluoro-1-[[2-(trifluoromethyl)phenyl]methyl]indole-6-carboxylate |
|---|---|
| PubChem CID | 159965960 |
| Molecular Formula | C36H25BrF8N2O3 |
| Molecular Weight | 765.50 g/mol |
| Exact Mass | 764.09 |
| IUPAC Name | 6-bromo-5-fluoro-1-[[2-(trifluoromethyl)phenyl]methyl]indole;carbon monoxide;ethyl 5-fluoro-1-[[2-(trifluoromethyl)phenyl]methyl]indole-6-carboxylate |
| SMILES | CCOC(=O)c1cc2c(ccn2Cc2ccccc2C(F)(F)F)cc1F.Fc1cc2ccn(Cc3ccccc3C(F)(F)F)c2cc1Br.[C-]#[O+] |
| InChI | InChI=1S/C19H15F4NO2.C16H10BrF4N.CO/c1-2-26-18(25)14-10-17-12(9-16(14)20)7-8-24(17)11-13-5-3-4-6-15(13)19(21,22)23;17-13-8-15-10(7-14(13)18)5-6-22(15)9-11-3-1-2-4-12(11)16(19,20)21;1-2/h3-10H,2,11H2,1H3;1-8H,9H2; |
| InChIKey | ODXXBRPQXYXHJM-UHFFFAOYSA-N |
| XLogP | 10.60 |
| TPSA | 56.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.50 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|