C29H25BrF3NO2 — CID 77264583
methyl 4-[1-(4-bromophenyl)-1-[7-(trifluoromethyl)quinolin-3-yl]pentan-2-yl]benzoate (PubChem CID 77264583) has the molecular formula C29H25BrF3NO2 and a molecular weight of 556.42 g/mol. Its IUPAC name is methyl 4-[1-(4-bromophenyl)-1-[7-(trifluoromethyl)quinolin-3-yl]pentan-2-yl]benzoate.
| Compound Name | methyl 4-[1-(4-bromophenyl)-1-[7-(trifluoromethyl)quinolin-3-yl]pentan-2-yl]benzoate |
|---|---|
| PubChem CID | 77264583 |
| Molecular Formula | C29H25BrF3NO2 |
| Molecular Weight | 556.42 g/mol |
| Exact Mass | 555.10 |
| IUPAC Name | methyl 4-[1-(4-bromophenyl)-1-[7-(trifluoromethyl)quinolin-3-yl]pentan-2-yl]benzoate |
| SMILES | CCCC(c1ccc(C(=O)OC)cc1)C(c1ccc(Br)cc1)c1cnc2cc(C(F)(F)F)ccc2c1 |
| InChI | InChI=1S/C29H25BrF3NO2/c1-3-4-25(18-5-7-20(8-6-18)28(35)36-2)27(19-10-13-24(30)14-11-19)22-15-21-9-12-23(29(31,32)33)16-26(21)34-17-22/h5-17,25,27H,3-4H2,1-2H3 |
| InChIKey | DOQKCZNCJFGRBV-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.42 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |