C24H24F3N3O2 — CID 67983601
ethyl 4-[1-[[5-[4-(trifluoromethyl)phenyl]pyrazin-2-yl]amino]butyl]benzoate (PubChem CID 67983601) has the molecular formula C24H24F3N3O2 and a molecular weight of 443.47 g/mol. Its IUPAC name is ethyl 4-[1-[[5-[4-(trifluoromethyl)phenyl]pyrazin-2-yl]amino]butyl]benzoate.
| Compound Name | ethyl 4-[1-[[5-[4-(trifluoromethyl)phenyl]pyrazin-2-yl]amino]butyl]benzoate |
|---|---|
| PubChem CID | 67983601 |
| Molecular Formula | C24H24F3N3O2 |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | ethyl 4-[1-[[5-[4-(trifluoromethyl)phenyl]pyrazin-2-yl]amino]butyl]benzoate |
| SMILES | CCCC(Nc1cnc(-c2ccc(C(F)(F)F)cc2)cn1)c1ccc(C(=O)OCC)cc1 |
| InChI | InChI=1S/C24H24F3N3O2/c1-3-5-20(16-6-8-18(9-7-16)23(31)32-4-2)30-22-15-28-21(14-29-22)17-10-12-19(13-11-17)24(25,26)27/h6-15,20H,3-5H2,1-2H3,(H,29,30) |
| InChIKey | UYFNGXOGYNKJOR-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |