C15H15F3N2OS — CID 87480063
N-butan-2-ylsulfanyl-7-(trifluoromethyl)quinoline-3-carboxamide (PubChem CID 87480063) has the molecular formula C15H15F3N2OS and a molecular weight of 328.36 g/mol. Its IUPAC name is N-butan-2-ylsulfanyl-7-(trifluoromethyl)quinoline-3-carboxamide.
| Compound Name | N-butan-2-ylsulfanyl-7-(trifluoromethyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 87480063 |
| Molecular Formula | C15H15F3N2OS |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | N-butan-2-ylsulfanyl-7-(trifluoromethyl)quinoline-3-carboxamide |
| SMILES | CCC(C)SNC(=O)c1cnc2cc(C(F)(F)F)ccc2c1 |
| InChI | InChI=1S/C15H15F3N2OS/c1-3-9(2)22-20-14(21)11-6-10-4-5-12(15(16,17)18)7-13(10)19-8-11/h4-9H,3H2,1-2H3,(H,20,21) |
| InChIKey | YQSZZYMILIAWBX-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|