About methane;3-methoxy-5-oxohexanoate;rubidium(1+)
methane;3-methoxy-5-oxohexanoate;rubidium(1+) (PubChem CID 157420385) has the molecular formula C9H19O4Rb
and a molecular weight of 276.71 g/mol. Its IUPAC name is methane;3-methoxy-5-oxohexanoate;rubidium(1+).
Molecular Properties
| Compound Name | methane;3-methoxy-5-oxohexanoate;rubidium(1+) |
| PubChem CID | 157420385 |
| Molecular Formula | C9H19O4Rb |
| Molecular Weight | 276.71 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | methane;3-methoxy-5-oxohexanoate;rubidium(1+) |
| SMILES | C.C.COC(CC(C)=O)CC(=O)[O-].[Rb+] |
| InChI | InChI=1S/C7H12O4.2CH4.Rb/c1-5(8)3-6(11-2)4-7(9)10;;;/h6H,3-4H2,1-2H3,(H,9,10);2*1H4;/q;;;+1/p-1 |
| InChIKey | BPIIYAYIAKUBSR-UHFFFAOYSA-M |
| XLogP | -2.60 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.71 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methane;3-methoxy-5-oxohexanoate;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;3-methoxy-5-oxohexanoate;rubidium(1+)?
The IUPAC name of methane;3-methoxy-5-oxohexanoate;rubidium(1+) (CID 157420385) is methane;3-methoxy-5-oxohexanoate;rubidium(1+).
What is the SMILES notation for methane;3-methoxy-5-oxohexanoate;rubidium(1+)?
The canonical SMILES for methane;3-methoxy-5-oxohexanoate;rubidium(1+) is C.C.COC(CC(C)=O)CC(=O)[O-].[Rb+].
What is the InChIKey of methane;3-methoxy-5-oxohexanoate;rubidium(1+)?
The InChIKey is BPIIYAYIAKUBSR-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H12O4.2CH4.Rb/c1-5(8)3-6(11-2)4-7(9)10;;;/h6H,3-4H2,1-2H3,(H,9,10);2*1H4;/q;;;+1/p-1.
What are the key properties of methane;3-methoxy-5-oxohexanoate;rubidium(1+)?
methane;3-methoxy-5-oxohexanoate;rubidium(1+) has a molecular weight of 276.71 g/mol, XLogP of -2.60, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methane;3-methoxy-5-oxohexanoate;rubidium(1+) is sourced from PubChem (CID 157420385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).