C22H19F4NO3 — CID 157420886
2-[(4S,4aS,5R)-7a-(2-fluorophenyl)-5-methyl-4-(trifluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]oxazin-2-yl]-1-phenylethanone (PubChem CID 157420886) has the molecular formula C22H19F4NO3 and a molecular weight of 421.39 g/mol. Its IUPAC name is 2-[(4S,4aS,5R)-7a-(2-fluorophenyl)-5-methyl-4-(trifluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]oxazin-2-yl]-1-phenylethanone.
| Compound Name | 2-[(4S,4aS,5R)-7a-(2-fluorophenyl)-5-methyl-4-(trifluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]oxazin-2-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 157420886 |
| Molecular Formula | C22H19F4NO3 |
| Molecular Weight | 421.39 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 2-[(4S,4aS,5R)-7a-(2-fluorophenyl)-5-methyl-4-(trifluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]oxazin-2-yl]-1-phenylethanone |
| SMILES | C[C@H]1OCC2(c3ccccc3F)N=C(CC(=O)c3ccccc3)O[C@H](C(F)(F)F)[C@H]12 |
| InChI | InChI=1S/C22H19F4NO3/c1-13-19-20(22(24,25)26)30-18(11-17(28)14-7-3-2-4-8-14)27-21(19,12-29-13)15-9-5-6-10-16(15)23/h2-10,13,19-20H,11-12H2,1H3/t13-,19+,20+,21?/m1/s1 |
| InChIKey | JMQWTHCBKFBMKC-AQSOYHOTSA-N |
| XLogP | 4.69 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.39 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |