C21H19F2NO2S — CID 59621351
2-[(4aS,5S,7aS)-5-(fluoromethyl)-7a-(2-fluorophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]-1-phenylethanone (PubChem CID 59621351) has the molecular formula C21H19F2NO2S and a molecular weight of 387.45 g/mol. Its IUPAC name is 2-[(4aS,5S,7aS)-5-(fluoromethyl)-7a-(2-fluorophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]-1-phenylethanone.
| Compound Name | 2-[(4aS,5S,7aS)-5-(fluoromethyl)-7a-(2-fluorophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 59621351 |
| Molecular Formula | C21H19F2NO2S |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 2-[(4aS,5S,7aS)-5-(fluoromethyl)-7a-(2-fluorophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]-1-phenylethanone |
| SMILES | O=C(CC1=N[C@@]2(c3ccccc3F)CO[C@H](CF)[C@H]2CS1)c1ccccc1 |
| InChI | InChI=1S/C21H19F2NO2S/c22-11-19-16-12-27-20(10-18(25)14-6-2-1-3-7-14)24-21(16,13-26-19)15-8-4-5-9-17(15)23/h1-9,16,19H,10-13H2/t16-,19-,21-/m1/s1 |
| InChIKey | PWRUNSSZLIMJJR-OZOXKJRCSA-N |
| XLogP | 4.42 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |