About 2-(bromomethyl)naphthalene;diethyl 2-(naphthalen-2-ylmethyl)propanedioate;diethyl propanedioate
2-(bromomethyl)naphthalene;diethyl 2-(naphthalen-2-ylmethyl)propanedioate;diethyl propanedioate (PubChem CID 157426488) has the molecular formula C36H41BrO8
and a molecular weight of 681.62 g/mol. Its IUPAC name is 2-(bromomethyl)naphthalene;diethyl 2-(naphthalen-2-ylmethyl)propanedioate;diethyl propanedioate.
Molecular Properties
| Compound Name | 2-(bromomethyl)naphthalene;diethyl 2-(naphthalen-2-ylmethyl)propanedioate;diethyl propanedioate |
| PubChem CID | 157426488 |
| Molecular Formula | C36H41BrO8 |
| Molecular Weight | 681.62 g/mol |
| Exact Mass | 680.20 |
| IUPAC Name | 2-(bromomethyl)naphthalene;diethyl 2-(naphthalen-2-ylmethyl)propanedioate;diethyl propanedioate |
| SMILES | BrCc1ccc2ccccc2c1.CCOC(=O)C(Cc1ccc2ccccc2c1)C(=O)OCC.CCOC(=O)CC(=O)OCC |
| InChI | InChI=1S/C18H20O4.C11H9Br.C7H12O4/c1-3-21-17(19)16(18(20)22-4-2)12-13-9-10-14-7-5-6-8-15(14)11-13;12-8-9-5-6-10-3-1-2-4-11(10)7-9;1-3-10-6(8)5-7(9)11-4-2/h5-11,16H,3-4,12H2,1-2H3;1-7H,8H2;3-5H2,1-2H3 |
| InChIKey | BQACMCJVHJAYBG-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 681.62 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-(bromomethyl)naphthalene;diethyl 2-(naphthalen-2-ylmethyl)propanedioate;diethyl propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(bromomethyl)naphthalene;diethyl 2-(naphthalen-2-ylmethyl)propanedioate;diethyl propanedioate?
The IUPAC name of 2-(bromomethyl)naphthalene;diethyl 2-(naphthalen-2-ylmethyl)propanedioate;diethyl propanedioate (CID 157426488) is 2-(bromomethyl)naphthalene;diethyl 2-(naphthalen-2-ylmethyl)propanedioate;diethyl propanedioate.
What is the SMILES notation for 2-(bromomethyl)naphthalene;diethyl 2-(naphthalen-2-ylmethyl)propanedioate;diethyl propanedioate?
The canonical SMILES for 2-(bromomethyl)naphthalene;diethyl 2-(naphthalen-2-ylmethyl)propanedioate;diethyl propanedioate is BrCc1ccc2ccccc2c1.CCOC(=O)C(Cc1ccc2ccccc2c1)C(=O)OCC.CCOC(=O)CC(=O)OCC.
What is the InChIKey of 2-(bromomethyl)naphthalene;diethyl 2-(naphthalen-2-ylmethyl)propanedioate;diethyl propanedioate?
The InChIKey is BQACMCJVHJAYBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O4.C11H9Br.C7H12O4/c1-3-21-17(19)16(18(20)22-4-2)12-13-9-10-14-7-5-6-8-15(14)11-13;12-8-9-5-6-10-3-1-2-4-11(10)7-9;1-3-10-6(8)5-7(9)11-4-2/h5-11,16H,3-4,12H2,1-2H3;1-7H,8H2;3-5H2,1-2H3.
What are the key properties of 2-(bromomethyl)naphthalene;diethyl 2-(naphthalen-2-ylmethyl)propanedioate;diethyl propanedioate?
2-(bromomethyl)naphthalene;diethyl 2-(naphthalen-2-ylmethyl)propanedioate;diethyl propanedioate has a molecular weight of 681.62 g/mol, XLogP of 7.36, 11 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(bromomethyl)naphthalene;diethyl 2-(naphthalen-2-ylmethyl)propanedioate;diethyl propanedioate is sourced from PubChem (CID 157426488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).