C27H36N4O6 — CID 157431033
(4-amino-5-methoxy-1-methylindol-2-yl)methanol;methyl 4-amino-5-methoxy-1-methylindole-2-carboxylate;oxolane (PubChem CID 157431033) has the molecular formula C27H36N4O6 and a molecular weight of 512.61 g/mol. Its IUPAC name is (4-amino-5-methoxy-1-methylindol-2-yl)methanol;methyl 4-amino-5-methoxy-1-methylindole-2-carboxylate;oxolane.
| Compound Name | (4-amino-5-methoxy-1-methylindol-2-yl)methanol;methyl 4-amino-5-methoxy-1-methylindole-2-carboxylate;oxolane |
|---|---|
| PubChem CID | 157431033 |
| Molecular Formula | C27H36N4O6 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | (4-amino-5-methoxy-1-methylindol-2-yl)methanol;methyl 4-amino-5-methoxy-1-methylindole-2-carboxylate;oxolane |
| SMILES | C1CCOC1.COC(=O)c1cc2c(N)c(OC)ccc2n1C.COc1ccc2c(cc(CO)n2C)c1N |
| InChI | InChI=1S/C12H14N2O3.C11H14N2O2.C4H8O/c1-14-8-4-5-10(16-2)11(13)7(8)6-9(14)12(15)17-3;1-13-7(6-14)5-8-9(13)3-4-10(15-2)11(8)12;1-2-4-5-3-1/h4-6H,13H2,1-3H3;3-5,14H,6,12H2,1-2H3;1-4H2 |
| InChIKey | BQNPOTDJOUPRKK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|