C17H22BrN2O4+ — CID 7302045
methyl 6-bromo-5-methoxy-1-methyl-2-(morpholin-4-ium-4-ylmethyl)indole-3-carboxylate (PubChem CID 7302045) has the molecular formula C17H22BrN2O4+ and a molecular weight of 398.28 g/mol. Its IUPAC name is methyl 6-bromo-5-methoxy-1-methyl-2-(morpholin-4-ium-4-ylmethyl)indole-3-carboxylate.
| Compound Name | methyl 6-bromo-5-methoxy-1-methyl-2-(morpholin-4-ium-4-ylmethyl)indole-3-carboxylate |
|---|---|
| PubChem CID | 7302045 |
| Molecular Formula | C17H22BrN2O4+ |
| Molecular Weight | 398.28 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | methyl 6-bromo-5-methoxy-1-methyl-2-(morpholin-4-ium-4-ylmethyl)indole-3-carboxylate |
| SMILES | COC(=O)c1c(C[NH+]2CCOCC2)n(C)c2cc(Br)c(OC)cc12 |
| InChI | InChI=1S/C17H21BrN2O4/c1-19-13-9-12(18)15(22-2)8-11(13)16(17(21)23-3)14(19)10-20-4-6-24-7-5-20/h8-9H,4-7,10H2,1-3H3/p+1 |
| InChIKey | IDSXHFOQKGQVNU-UHFFFAOYSA-O |
| XLogP | 1.15 |
| TPSA | 54.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |