C22H30BrN3O2 — CID 5298865
[6-bromo-5-methoxy-1-methyl-2-(piperidin-1-ylmethyl)indol-3-yl]-piperidin-1-ylmethanone (PubChem CID 5298865) has the molecular formula C22H30BrN3O2 and a molecular weight of 448.41 g/mol. Its IUPAC name is [6-bromo-5-methoxy-1-methyl-2-(piperidin-1-ylmethyl)indol-3-yl]-piperidin-1-ylmethanone.
| Compound Name | [6-bromo-5-methoxy-1-methyl-2-(piperidin-1-ylmethyl)indol-3-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 5298865 |
| Molecular Formula | C22H30BrN3O2 |
| Molecular Weight | 448.41 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | [6-bromo-5-methoxy-1-methyl-2-(piperidin-1-ylmethyl)indol-3-yl]-piperidin-1-ylmethanone |
| SMILES | COc1cc2c(C(=O)N3CCCCC3)c(CN3CCCCC3)n(C)c2cc1Br |
| InChI | InChI=1S/C22H30BrN3O2/c1-24-18-14-17(23)20(28-2)13-16(18)21(22(27)26-11-7-4-8-12-26)19(24)15-25-9-5-3-6-10-25/h13-14H,3-12,15H2,1-2H3 |
| InChIKey | GHRMTRQOIFGTFT-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.41 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |