C14H18F6N4O4S2 — CID 157432526
2,4-bis(trifluoromethylsulfonyl)imidazol-1-ide;1-butyl-3-ethylimidazol-1-ium (PubChem CID 157432526) has the molecular formula C14H18F6N4O4S2 and a molecular weight of 484.44 g/mol. Its IUPAC name is 2,4-bis(trifluoromethylsulfonyl)imidazol-1-ide;1-butyl-3-ethylimidazol-1-ium.
| Compound Name | 2,4-bis(trifluoromethylsulfonyl)imidazol-1-ide;1-butyl-3-ethylimidazol-1-ium |
|---|---|
| PubChem CID | 157432526 |
| Molecular Formula | C14H18F6N4O4S2 |
| Molecular Weight | 484.44 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | 2,4-bis(trifluoromethylsulfonyl)imidazol-1-ide;1-butyl-3-ethylimidazol-1-ium |
| SMILES | CCCC[n+]1ccn(CC)c1.O=S(=O)(c1c[n-]c(S(=O)(=O)C(F)(F)F)n1)C(F)(F)F |
| InChI | InChI=1S/C9H17N2.C5HF6N2O4S2/c1-3-5-6-11-8-7-10(4-2)9-11;6-4(7,8)18(14,15)2-1-12-3(13-2)19(16,17)5(9,10)11/h7-9H,3-6H2,1-2H3;1H/q+1;-1 |
| InChIKey | BQSBVEZPRBIGJY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 104.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|