C30H36N4O2 — CID 157432602
2-(1,3-dimethyl-6-propan-2-ylindol-5-yl)oxyacetonitrile (PubChem CID 157432602) has the molecular formula C30H36N4O2 and a molecular weight of 484.64 g/mol. Its IUPAC name is 2-(1,3-dimethyl-6-propan-2-ylindol-5-yl)oxyacetonitrile.
| Compound Name | 2-(1,3-dimethyl-6-propan-2-ylindol-5-yl)oxyacetonitrile |
|---|---|
| PubChem CID | 157432602 |
| Molecular Formula | C30H36N4O2 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | 2-(1,3-dimethyl-6-propan-2-ylindol-5-yl)oxyacetonitrile |
| SMILES | Cc1cn(C)c2cc(C(C)C)c(OCC#N)cc12.Cc1cn(C)c2cc(C(C)C)c(OCC#N)cc12 |
| InChI | InChI=1S/2C15H18N2O/c2*1-10(2)12-7-14-13(11(3)9-17(14)4)8-15(12)18-6-5-16/h2*7-10H,6H2,1-4H3 |
| InChIKey | BQSIMMJKHQAJTF-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 75.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |