C26H30Cl2N2O3 — CID 162031098
2-(5-chloro-4-methyl-2-propan-2-ylphenoxy)acetonitrile;(E)-2-(5-chloro-4-methyl-2-propan-2-ylphenoxy)-3-methoxyprop-2-enenitrile (PubChem CID 162031098) has the molecular formula C26H30Cl2N2O3 and a molecular weight of 489.44 g/mol. Its IUPAC name is 2-(5-chloro-4-methyl-2-propan-2-ylphenoxy)acetonitrile;(E)-2-(5-chloro-4-methyl-2-propan-2-ylphenoxy)-3-methoxyprop-2-enenitrile.
| Compound Name | 2-(5-chloro-4-methyl-2-propan-2-ylphenoxy)acetonitrile;(E)-2-(5-chloro-4-methyl-2-propan-2-ylphenoxy)-3-methoxyprop-2-enenitrile |
|---|---|
| PubChem CID | 162031098 |
| Molecular Formula | C26H30Cl2N2O3 |
| Molecular Weight | 489.44 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 2-(5-chloro-4-methyl-2-propan-2-ylphenoxy)acetonitrile;(E)-2-(5-chloro-4-methyl-2-propan-2-ylphenoxy)-3-methoxyprop-2-enenitrile |
| SMILES | CO/C=C(\C#N)Oc1cc(Cl)c(C)cc1C(C)C.Cc1cc(C(C)C)c(OCC#N)cc1Cl |
| InChI | InChI=1S/C14H16ClNO2.C12H14ClNO/c1-9(2)12-5-10(3)13(15)6-14(12)18-11(7-16)8-17-4;1-8(2)10-6-9(3)11(13)7-12(10)15-5-4-14/h5-6,8-9H,1-4H3;6-8H,5H2,1-3H3/b11-8+; |
| InChIKey | YWANLSVBUMDFNA-YGCVIUNWSA-N |
| XLogP | 7.84 |
| TPSA | 75.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.44 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|