C14H16BrNO3 — CID 59598621
(E)-2-(5-bromo-4-methoxy-2-propan-2-ylphenoxy)-3-methoxyprop-2-enenitrile (PubChem CID 59598621) has the molecular formula C14H16BrNO3 and a molecular weight of 326.19 g/mol. Its IUPAC name is (E)-2-(5-bromo-4-methoxy-2-propan-2-ylphenoxy)-3-methoxyprop-2-enenitrile.
| Compound Name | (E)-2-(5-bromo-4-methoxy-2-propan-2-ylphenoxy)-3-methoxyprop-2-enenitrile |
|---|---|
| PubChem CID | 59598621 |
| Molecular Formula | C14H16BrNO3 |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | (E)-2-(5-bromo-4-methoxy-2-propan-2-ylphenoxy)-3-methoxyprop-2-enenitrile |
| SMILES | CO/C=C(\C#N)Oc1cc(Br)c(OC)cc1C(C)C |
| InChI | InChI=1S/C14H16BrNO3/c1-9(2)11-5-14(18-4)12(15)6-13(11)19-10(7-16)8-17-3/h5-6,8-9H,1-4H3/b10-8+ |
| InChIKey | YGTNHNMMMJZLED-CSKARUKUSA-N |
| XLogP | 3.97 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|