C12H12I2N2O2 — CID 76590305
2-(2,5-diiodo-4-methoxyphenoxy)-3-(dimethylamino)prop-2-enenitrile (PubChem CID 76590305) has the molecular formula C12H12I2N2O2 and a molecular weight of 470.05 g/mol. Its IUPAC name is 2-(2,5-diiodo-4-methoxyphenoxy)-3-(dimethylamino)prop-2-enenitrile.
| Compound Name | 2-(2,5-diiodo-4-methoxyphenoxy)-3-(dimethylamino)prop-2-enenitrile |
|---|---|
| PubChem CID | 76590305 |
| Molecular Formula | C12H12I2N2O2 |
| Molecular Weight | 470.05 g/mol |
| Exact Mass | 469.90 |
| IUPAC Name | 2-(2,5-diiodo-4-methoxyphenoxy)-3-(dimethylamino)prop-2-enenitrile |
| SMILES | COc1cc(I)c(OC(C#N)=CN(C)C)cc1I |
| InChI | InChI=1S/C12H12I2N2O2/c1-16(2)7-8(6-15)18-12-5-9(13)11(17-3)4-10(12)14/h4-5,7H,1-3H3 |
| InChIKey | POXGZZSFSTZEBE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.05 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|