C17H15I4NO2 — CID 158897966
1,4-diiodo-2-methoxy-5-methylbenzene;2-(2,5-diiodo-4-methylphenoxy)acetonitrile (PubChem CID 158897966) has the molecular formula C17H15I4NO2 and a molecular weight of 772.93 g/mol. Its IUPAC name is 1,4-diiodo-2-methoxy-5-methylbenzene;2-(2,5-diiodo-4-methylphenoxy)acetonitrile.
| Compound Name | 1,4-diiodo-2-methoxy-5-methylbenzene;2-(2,5-diiodo-4-methylphenoxy)acetonitrile |
|---|---|
| PubChem CID | 158897966 |
| Molecular Formula | C17H15I4NO2 |
| Molecular Weight | 772.93 g/mol |
| Exact Mass | 772.73 |
| IUPAC Name | 1,4-diiodo-2-methoxy-5-methylbenzene;2-(2,5-diiodo-4-methylphenoxy)acetonitrile |
| SMILES | COc1cc(I)c(C)cc1I.Cc1cc(I)c(OCC#N)cc1I |
| InChI | InChI=1S/C9H7I2NO.C8H8I2O/c1-6-4-8(11)9(5-7(6)10)13-3-2-12;1-5-3-7(10)8(11-2)4-6(5)9/h4-5H,3H2,1H3;3-4H,1-2H3 |
| InChIKey | JFBQCJPONQLLDL-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.93 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|