C60H40N14O4S — CID 157435869
2,9-bis(6-pyridin-2-ylpyridazin-3-yl)-1,10-phenanthroline;2,9-bis(5-pyridin-2-yl-1H-pyrrol-2-yl)-1,10-phenanthroline;sulfuric acid (PubChem CID 157435869) has the molecular formula C60H40N14O4S and a molecular weight of 1053.14 g/mol. Its IUPAC name is 2,9-bis(6-pyridin-2-ylpyridazin-3-yl)-1,10-phenanthroline;2,9-bis(5-pyridin-2-yl-1H-pyrrol-2-yl)-1,10-phenanthroline;sulfuric acid.
| Compound Name | 2,9-bis(6-pyridin-2-ylpyridazin-3-yl)-1,10-phenanthroline;2,9-bis(5-pyridin-2-yl-1H-pyrrol-2-yl)-1,10-phenanthroline;sulfuric acid |
|---|---|
| PubChem CID | 157435869 |
| Molecular Formula | C60H40N14O4S |
| Molecular Weight | 1053.14 g/mol |
| Exact Mass | 1052.31 |
| IUPAC Name | 2,9-bis(6-pyridin-2-ylpyridazin-3-yl)-1,10-phenanthroline;2,9-bis(5-pyridin-2-yl-1H-pyrrol-2-yl)-1,10-phenanthroline;sulfuric acid |
| SMILES | O=S(=O)(O)O.c1ccc(-c2ccc(-c3ccc4ccc5ccc(-c6ccc(-c7ccccn7)[nH]6)nc5c4n3)[nH]2)nc1.c1ccc(-c2ccc(-c3ccc4ccc5ccc(-c6ccc(-c7ccccn7)nn6)nc5c4n3)nn2)nc1 |
| InChI | InChI=1S/C30H18N8.C30H20N6.H2O4S/c1-3-17-31-21(5-1)25-13-15-27(37-35-25)23-11-9-19-7-8-20-10-12-24(34-30(20)29(19)33-23)28-16-14-26(36-38-28)22-6-2-4-18-32-22;1-3-17-31-21(5-1)23-13-15-25(33-23)27-11-9-19-7-8-20-10-12-28(36-30(20)29(19)35-27)26-16-14-24(34-26)22-6-2-4-18-32-22;1-5(2,3)4/h1-18H;1-18,33-34H;(H2,1,2,3,4) |
| InChIKey | CMIPOZYQWMJEDA-UHFFFAOYSA-N |
| XLogP | 12.07 |
| TPSA | 260.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 79 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1053.14 |
| LogP ≤ 5 | 12.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|